EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17FO4S |
| Net Charge | 0 |
| Average Mass | 372.417 |
| Monoisotopic Mass | 372.08316 |
| SMILES | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H17FO4S/c1-12-17(9-13-3-6-15(7-4-13)26(2,24)25)16-8-5-14(21)10-19(16)18(12)11-20(22)23/h3-10H,11H2,1-2H3,(H,22,23)/b17-9- |
| InChIKey | MVGSNCBCUWPVDA-MFOYZWKCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulindac sulfone (CHEBI:64212) has functional parent sulindac (CHEBI:9352) |
| sulindac sulfone (CHEBI:64212) has role apoptosis inducer (CHEBI:68495) |
| sulindac sulfone (CHEBI:64212) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| sulindac sulfone (CHEBI:64212) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| sulindac sulfone (CHEBI:64212) is a monocarboxylic acid (CHEBI:25384) |
| sulindac sulfone (CHEBI:64212) is a organofluorine compound (CHEBI:37143) |
| sulindac sulfone (CHEBI:64212) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| {(1Z)-5-fluoro-2-methyl-1-[4-(methylsulfonyl)benzylidene]-1H-inden-3-yl}acetic acid |
| INN | Source |
|---|---|
| exisulind | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Fluoro-2-methyl-1-((Z)-p-(methylsulfonyl)benzylidene)indene-3-acetic acid | ChEBI |
| cis-5-Fluoro-2-methyl-1-(p-methylsulfonylbenzylidenyl)indene-3-acetic acid | ChEBI |
| Citations |
|---|