EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2S2 |
| Net Charge | +2 |
| Average Mass | 358.576 |
| Monoisotopic Mass | 358.15264 |
| SMILES | CSc1ccc2c(c1)C([NH+]1CC[NH+](C)CC1)Cc1ccccc1S2 |
| InChI | InChI=1S/C20H24N2S2/c1-21-9-11-22(12-10-21)18-13-15-5-3-4-6-19(15)24-20-8-7-16(23-2)14-17(18)20/h3-8,14,18H,9-13H2,1-2H3/p+2 |
| InChIKey | RLJFTICUTYVZDG-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methiothepin(2+) (CHEBI:64204) is a ammonium ion derivative (CHEBI:35274) |
| methiothepin(2+) (CHEBI:64204) is a organic cation (CHEBI:25697) |
| methiothepin(2+) (CHEBI:64204) is conjugate acid of methiothepin (CHEBI:64203) |
| Incoming Relation(s) |
| methiothepin maleate (CHEBI:64202) has part methiothepin(2+) (CHEBI:64204) |
| methiothepin (CHEBI:64203) is conjugate base of methiothepin(2+) (CHEBI:64204) |
| IUPAC Name |
|---|
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazinediium |
| Synonym | Source |
|---|---|
| methiothepin cation | ChEBI |