EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2S2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 472.632 |
| Monoisotopic Mass | 472.14905 |
| SMILES | CSc1ccc2c(c1)C(N1CCN(C)CC1)Cc1ccccc1S2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H24N2S2.C4H4O4/c1-21-9-11-22(12-10-21)18-13-15-5-3-4-6-19(15)24-20-8-7-16(23-2)14-17(18)20;5-3(6)1-2-4(7)8/h3-8,14,18H,9-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | IWDBEHWZGDSFHR-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methiothepin maleate (CHEBI:64202) has part methiothepin(2+) (CHEBI:64204) |
| methiothepin maleate (CHEBI:64202) has role antipsychotic agent (CHEBI:35476) |
| methiothepin maleate (CHEBI:64202) has role dopaminergic antagonist (CHEBI:48561) |
| methiothepin maleate (CHEBI:64202) has role serotonergic antagonist (CHEBI:48279) |
| methiothepin maleate (CHEBI:64202) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 1-(10,11-Dihydro-8-(methylthio)dibenzo(b,f)thiepin-10-yl)-4-methylpiperazine maleate | ChemIDplus |
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazinediium (2Z)-but-2-enedioate | IUPAC |
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine maleate | ChEBI |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine (2Z)-but-2-enedioate | ChEBI |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazinediium (2Z)-but-2-enedioate | ChEBI |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine maleate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4119981 | Reaxys |
| CAS:19728-88-2 | ChemIDplus |
| Citations |
|---|