EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2S2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 472.632 |
| Monoisotopic Mass | 472.14905 |
| SMILES | CSc1ccc2c(c1)C(N1CCN(C)CC1)Cc1ccccc1S2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H24N2S2.C4H4O4/c1-21-9-11-22(12-10-21)18-13-15-5-3-4-6-19(15)24-20-8-7-16(23-2)14-17(18)20;5-3(6)1-2-4(7)8/h3-8,14,18H,9-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | IWDBEHWZGDSFHR-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methiothepin maleate (CHEBI:64202) has part methiothepin(2+) (CHEBI:64204) |
| methiothepin maleate (CHEBI:64202) has role antipsychotic agent (CHEBI:35476) |
| methiothepin maleate (CHEBI:64202) has role dopaminergic antagonist (CHEBI:48561) |
| methiothepin maleate (CHEBI:64202) has role serotonergic antagonist (CHEBI:48279) |
| methiothepin maleate (CHEBI:64202) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 1-(10,11-Dihydro-8-(methylthio)dibenzo(b,f)thiepin-10-yl)-4-methylpiperazine maleate | ChemIDplus |
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazinediium (2Z)-but-2-enedioate | IUPAC |
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine maleate | ChEBI |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine (2Z)-but-2-enedioate | ChEBI |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazinediium (2Z)-but-2-enedioate | ChEBI |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine maleate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4119981 | Reaxys |
| CAS:19728-88-2 | ChemIDplus |
| Citations |
|---|