EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2S2 |
| Net Charge | 0 |
| Average Mass | 356.560 |
| Monoisotopic Mass | 356.13809 |
| SMILES | CSc1ccc2c(c1)C(N1CCN(C)CC1)Cc1ccccc1S2 |
| InChI | InChI=1S/C20H24N2S2/c1-21-9-11-22(12-10-21)18-13-15-5-3-4-6-19(15)24-20-8-7-16(23-2)14-17(18)20/h3-8,14,18H,9-13H2,1-2H3 |
| InChIKey | RLJFTICUTYVZDG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methiothepin (CHEBI:64203) has role antipsychotic agent (CHEBI:35476) |
| methiothepin (CHEBI:64203) has role dopaminergic antagonist (CHEBI:48561) |
| methiothepin (CHEBI:64203) has role geroprotector (CHEBI:176497) |
| methiothepin (CHEBI:64203) has role serotonergic antagonist (CHEBI:48279) |
| methiothepin (CHEBI:64203) is a N-alkylpiperazine (CHEBI:46845) |
| methiothepin (CHEBI:64203) is a aryl sulfide (CHEBI:35683) |
| methiothepin (CHEBI:64203) is a dibenzothiepine (CHEBI:38924) |
| methiothepin (CHEBI:64203) is a tertiary amino compound (CHEBI:50996) |
| methiothepin (CHEBI:64203) is conjugate base of methiothepin(2+) (CHEBI:64204) |
| Incoming Relation(s) |
| methiothepin(2+) (CHEBI:64204) is conjugate acid of methiothepin (CHEBI:64203) |
| IUPAC Name |
|---|
| 1-methyl-4-[8-(methylsulfanyl)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine |
| INNs | Source |
|---|---|
| metitepina | ChemIDplus |
| metitepine | ChemIDplus |
| metitepinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+-)-10-(4-Methylpiperazinyl)-8-(methylthio)-10,11-dihydrodibenzo(b,f)thiepin | ChemIDplus |
| (+-)-1-(10,11-Dihydro-8-(methylthio)dibenzo(b,f)thiepin-10-yl)-4-methylpiperazine | ChemIDplus |
| 1-(10,11-Dihydro-8-(methylthio)dibenzo(b,f)thiepin-10-yl)-4-methylpiperazine | ChemIDplus |
| 1-methyl-4-[8-(methylthio)-10,11-dihydrodibenzo[b,f]thiepin-10-yl]piperazine | ChEBI |
| (+-)-8-Methylthio-10-(4-methylpiperazino)-10,11-dihydrodibenzo(b,f)thiepin | ChemIDplus |
| Methiothepine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0254534 | HMDB |
| LSM-4320 | LINCS |
| Metitepine | Wikipedia |
| NL6608618 | Patent |
| US3379729 | Patent |
| US4444778 | Patent |
| US6331536 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:626221 | Reaxys |
| CAS:20229-30-5 | ChemIDplus |
| Citations |
|---|