EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N2O2 |
| Net Charge | +1 |
| Average Mass | 375.492 |
| Monoisotopic Mass | 375.20670 |
| SMILES | O=C(O)c1ccc2ncc(CCCC[NH+]3CC=C(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C24H26N2O2/c27-24(28)20-9-10-23-22(16-20)21(17-25-23)8-4-5-13-26-14-11-19(12-15-26)18-6-2-1-3-7-18/h1-3,6-7,9-11,16-17,25H,4-5,8,12-15H2,(H,27,28)/p+1 |
| InChIKey | AFSOIHMEOKEZJF-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carmoxirole(1+) (CHEBI:64201) is a ammonium ion derivative (CHEBI:35274) |
| carmoxirole(1+) (CHEBI:64201) is a organic cation (CHEBI:25697) |
| carmoxirole(1+) (CHEBI:64201) is conjugate acid of carmoxirole (CHEBI:64200) |
| Incoming Relation(s) |
| carmoxirole hydrochloride (CHEBI:64199) has part carmoxirole(1+) (CHEBI:64201) |
| carmoxirole (CHEBI:64200) is conjugate base of carmoxirole(1+) (CHEBI:64201) |
| IUPAC Name |
|---|
| 1-[4-(5-carboxy-1H-indol-3-yl)butyl]-4-phenyl-1,2,3,6-tetrahydropyridinium |
| Synonym | Source |
|---|---|
| carmoxirole cation | ChEBI |