EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 410.945 |
| Monoisotopic Mass | 410.17611 |
| SMILES | Cl.O=C(O)c1ccc2ncc(CCCCN3CC=C(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C24H26N2O2.ClH/c27-24(28)20-9-10-23-22(16-20)21(17-25-23)8-4-5-13-26-14-11-19(12-15-26)18-6-2-1-3-7-18;/h1-3,6-7,9-11,16-17,25H,4-5,8,12-15H2,(H,27,28);1H |
| InChIKey | LRJUHOBITQUXIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | dopamine agonist A drug that binds to and activates dopamine receptors. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carmoxirole hydrochloride (CHEBI:64199) has part carmoxirole(1+) (CHEBI:64201) |
| carmoxirole hydrochloride (CHEBI:64199) has role antihypertensive agent (CHEBI:35674) |
| carmoxirole hydrochloride (CHEBI:64199) has role dopamine agonist (CHEBI:51065) |
| carmoxirole hydrochloride (CHEBI:64199) has role platelet aggregation inhibitor (CHEBI:50427) |
| carmoxirole hydrochloride (CHEBI:64199) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-[4-(4-phenyl-3,6-dihydropyridin-1(2H)-yl)butyl]-1H-indole-5-carboxylic acid hydrochloride |
| Synonym | Source |
|---|---|
| 1-[4-(5-carboxy-1H-indol-3-yl)butyl]-4-phenyl-1,2,3,6-tetrahydropyridinium chloride | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5689787 | Reaxys |