EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O2 |
| Net Charge | 0 |
| Average Mass | 374.484 |
| Monoisotopic Mass | 374.19943 |
| SMILES | O=C(O)c1ccc2ncc(CCCCN3CC=C(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C24H26N2O2/c27-24(28)20-9-10-23-22(16-20)21(17-25-23)8-4-5-13-26-14-11-19(12-15-26)18-6-2-1-3-7-18/h1-3,6-7,9-11,16-17,25H,4-5,8,12-15H2,(H,27,28) |
| InChIKey | AFSOIHMEOKEZJF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. dopamine agonist A drug that binds to and activates dopamine receptors. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carmoxirole (CHEBI:64200) has role antihypertensive agent (CHEBI:35674) |
| carmoxirole (CHEBI:64200) has role dopamine agonist (CHEBI:51065) |
| carmoxirole (CHEBI:64200) has role platelet aggregation inhibitor (CHEBI:50427) |
| carmoxirole (CHEBI:64200) is a indolecarboxylic acid (CHEBI:38610) |
| carmoxirole (CHEBI:64200) is a tertiary amino compound (CHEBI:50996) |
| carmoxirole (CHEBI:64200) is a tetrahydropyridine (CHEBI:26921) |
| carmoxirole (CHEBI:64200) is conjugate base of carmoxirole(1+) (CHEBI:64201) |
| Incoming Relation(s) |
| carmoxirole(1+) (CHEBI:64201) is conjugate acid of carmoxirole (CHEBI:64200) |
| IUPAC Name |
|---|
| 3-[4-(4-phenyl-3,6-dihydropyridin-1(2H)-yl)butyl]-1H-indole-5-carboxylic acid |
| INNs | Source |
|---|---|
| carmoxirol | ChemIDplus |
| carmoxirolum | ChemIDplus |
| carmoxirole | ChemIDplus |
| Synonym | Source |
|---|---|
| 3-(4-(3,6-Dihydro-4-phenyl-1(2H)-pyridyl)butyl)indole-5-carboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5772553 | Reaxys |
| CAS:98323-83-2 | ChemIDplus |
| Citations |
|---|