EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N3O5 |
| Net Charge | +1 |
| Average Mass | 258.254 |
| Monoisotopic Mass | 258.10845 |
| SMILES | [NH3+]C(CO)C(=O)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C10H15N3O5/c11-6(4-14)10(18)13-12-3-5-1-2-7(15)9(17)8(5)16/h1-2,6,12,14-17H,3-4,11H2,(H,13,18)/p+1 |
| InChIKey | BNQDCRGUHNALGH-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benserazide(1+) (CHEBI:64190) is a ammonium ion derivative (CHEBI:35274) |
| benserazide(1+) (CHEBI:64190) is conjugate acid of benserazide (CHEBI:64187) |
| Incoming Relation(s) |
| benserazide hydrochloride (CHEBI:31262) has part benserazide(1+) (CHEBI:64190) |
| benserazide (CHEBI:64187) is conjugate base of benserazide(1+) (CHEBI:64190) |
| IUPAC Name |
|---|
| 3-hydroxy-1-oxo-1-[2-(2,3,4-trihydroxybenzyl)hydrazinyl]propan-2-aminium |