EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3O5 |
| Net Charge | 0 |
| Average Mass | 257.246 |
| Monoisotopic Mass | 257.10117 |
| SMILES | NC(CO)C(=O)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C10H15N3O5/c11-6(4-14)10(18)13-12-3-5-1-2-7(15)9(17)8(5)16/h1-2,6,12,14-17H,3-4,11H2,(H,13,18) |
| InChIKey | BNQDCRGUHNALGH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of aromatic-L-amino-acid decarboxylase (EC 4.1.1.28). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benserazide (CHEBI:64187) has role antiparkinson drug (CHEBI:48407) |
| benserazide (CHEBI:64187) has role dopaminergic agent (CHEBI:48560) |
| benserazide (CHEBI:64187) has role EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor (CHEBI:59321) |
| benserazide (CHEBI:64187) is a carbohydrazide (CHEBI:35363) |
| benserazide (CHEBI:64187) is a catechols (CHEBI:33566) |
| benserazide (CHEBI:64187) is a primary alcohol (CHEBI:15734) |
| benserazide (CHEBI:64187) is a primary amino compound (CHEBI:50994) |
| benserazide (CHEBI:64187) is conjugate base of benserazide(1+) (CHEBI:64190) |
| Incoming Relation(s) |
| benserazide(1+) (CHEBI:64190) is conjugate acid of benserazide (CHEBI:64187) |
| IUPAC Name |
|---|
| 2-amino-3-hydroxy-N'-(2,3,4-trihydroxybenzyl)propanehydrazide |
| INNs | Source |
|---|---|
| benserazidum | ChemIDplus |
| benserazida | ChemIDplus |
| benserazide | ChemIDplus |
| Synonyms | Source |
|---|---|
| DL-serine 2-(2,3,4-trihydroxybenzyl)hydrazide | ChemIDplus |
| DL-serine 2-[(2,3,4-trihydroxyphenyl)methyl]hydrazide | ChemIDplus |
| Ro 44602 | ChemIDplus |
| Ro 4-4602 | ChemIDplus |
| Citations |
|---|