EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3O5.HCl |
| Net Charge | 0 |
| Average Mass | 293.707 |
| Monoisotopic Mass | 293.07785 |
| SMILES | Cl.NC(CO)C(=O)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C10H15N3O5.ClH/c11-6(4-14)10(18)13-12-3-5-1-2-7(15)9(17)8(5)16;/h1-2,6,12,14-17H,3-4,11H2,(H,13,18);1H |
| InChIKey | ULFCBIUXQQYDEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of aromatic-L-amino-acid decarboxylase (EC 4.1.1.28). |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benserazide hydrochloride (CHEBI:31262) has part benserazide(1+) (CHEBI:64190) |
| benserazide hydrochloride (CHEBI:31262) has role antiparkinson drug (CHEBI:48407) |
| benserazide hydrochloride (CHEBI:31262) has role dopaminergic agent (CHEBI:48560) |
| benserazide hydrochloride (CHEBI:31262) has role EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor (CHEBI:59321) |
| benserazide hydrochloride (CHEBI:31262) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-amino-3-hydroxy-N'-(2,3,4-trihydroxybenzyl)propanehydrazide hydrochloride |
| Synonyms | Source |
|---|---|
| 2'-(2,3,4-trihydroxybenzyl)-DL-serinohydrazide monohydrochloride | ChemIDplus |
| 3-hydroxy-1-oxo-1-[2-(2,3,4-trihydroxybenzyl)hydrazinyl]propan-2-aminium chloride | IUPAC |
| benserazide HCl | ChemIDplus |
| Ro 4-4602/001 | ChemIDplus |
| DL-serine 2-(2,3,4-trihydroxybenzyl)hydrazine hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01653 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6494463 | Reaxys |
| CAS:14919-77-8 | KEGG DRUG |
| CAS:14919-77-8 | ChemIDplus |