EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O4S |
| Net Charge | 0 |
| Average Mass | 341.433 |
| Monoisotopic Mass | 341.14093 |
| SMILES | CCN1CCC[C@@H]1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C15H23N3O4S/c1-3-18-8-4-5-11(18)10-17-15(19)13-9-12(23(16,20)21)6-7-14(13)22-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-/m1/s1 |
| InChIKey | BGRJTUBHPOOWDU-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-(+)-sulpiride (CHEBI:64122) is a sulpiride (CHEBI:32168) |
| (R)-(+)-sulpiride (CHEBI:64122) is enantiomer of (S)-(−)-sulpiride (CHEBI:64119) |
| Incoming Relation(s) |
| (S)-(−)-sulpiride (CHEBI:64119) is enantiomer of (R)-(+)-sulpiride (CHEBI:64122) |
| Synonyms | Source |
|---|---|
| (R)-(+)-5-aminosulfonyl-N-[(1-ethyl-2-pyrrolidinyl)methyl]-2-methoxybenzamide | ChEBI |
| (R)-(-)-N-[(1-Ethyl-2-pyrrolidinyl)methyl]-5-sulfamoyl-o-anisamide | ChEBI |
| (R)-sulpiride | ChEBI |
| (+)-sulpiride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4298776 | Reaxys |
| CAS:23756-79-8 | ChemIDplus |