EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O4S |
| Net Charge | 0 |
| Average Mass | 341.433 |
| Monoisotopic Mass | 341.14093 |
| SMILES | CCN1CCC[C@H]1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C15H23N3O4S/c1-3-18-8-4-5-11(18)10-17-15(19)13-9-12(23(16,20)21)6-7-14(13)22-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-/m0/s1 |
| InChIKey | BGRJTUBHPOOWDU-NSHDSACASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(−)-sulpiride (CHEBI:64119) has role antidepressant (CHEBI:35469) |
| (S)-(−)-sulpiride (CHEBI:64119) has role antiemetic (CHEBI:50919) |
| (S)-(−)-sulpiride (CHEBI:64119) has role antipsychotic agent (CHEBI:35476) |
| (S)-(−)-sulpiride (CHEBI:64119) has role dopaminergic antagonist (CHEBI:48561) |
| (S)-(−)-sulpiride (CHEBI:64119) is a sulpiride (CHEBI:32168) |
| (S)-(−)-sulpiride (CHEBI:64119) is enantiomer of (R)-(+)-sulpiride (CHEBI:64122) |
| Incoming Relation(s) |
| (R)-(+)-sulpiride (CHEBI:64122) is enantiomer of (S)-(−)-sulpiride (CHEBI:64119) |
| IUPAC Name |
|---|
| N-{[(2S)-1-ethylpyrrolidin-2-yl]methyl}-2-methoxy-5-sulfamoylbenzamide |
| INNs | Source |
|---|---|
| levosulpirida | DrugBank |
| levosulpiride | KEGG DRUG |
| levosulpiridum | DrugBank |
| Synonyms | Source |
|---|---|
| (S)-(−)-5-aminosulfonyl-N-[(1-ethyl-2-pyrrolidinyl)methyl]-2-methoxybenzamide | ChEBI |
| (S)-sulpiride | ChEBI |
| Levopraid | ChEMBL |
| levosulpiride | ChEMBL |
| (-)-N-(((S)-1-Ethyl-2-pyrrolidinyl)methyl)-5-sulfamoyl-o-anisamide | ChemIDplus |
| S-(-)-N-(1-Ethyl-2-pyrrolidinomethyl)-2-methoxy-5-sulfamoylebenzamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1577 | DrugCentral |
| D07312 | KEGG DRUG |
| DB00391 | DrugBank |
| KR20110090142 | Patent |
| Levosulpiride | Wikipedia |
| LSM-5624 | LINCS |
| US2011052700 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3563418 | Reaxys |
| CAS:23672-07-3 | ChemIDplus |
| Citations |
|---|