EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32168 - sulpiride
| Formula | C15H23N3O4S |
| Net Charge | 0 |
| Average Mass | 341.433 |
| Monoisotopic Mass | 341.14093 |
| SMILES | CCN1CCCC1CNC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C15H23N3O4S/c1-3-18-8-4-5-11(18)10-17-15(19)13-9-12(23(16,20)21)6-7-14(13)22-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,17,19)(H2,16,20,21) |
| InChIKey | BGRJTUBHPOOWDU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulpiride (CHEBI:32168) has role antidepressant (CHEBI:35469) |
| sulpiride (CHEBI:32168) has role antiemetic (CHEBI:50919) |
| sulpiride (CHEBI:32168) has role antipsychotic agent (CHEBI:35476) |
| sulpiride (CHEBI:32168) has role dopaminergic antagonist (CHEBI:48561) |
| sulpiride (CHEBI:32168) is a N-alkylpyrrolidine (CHEBI:46775) |
| sulpiride (CHEBI:32168) is a benzamides (CHEBI:22702) |
| sulpiride (CHEBI:32168) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| (R)-(+)-sulpiride (CHEBI:64122) is a sulpiride (CHEBI:32168) |
| (S)-(−)-sulpiride (CHEBI:64119) is a sulpiride (CHEBI:32168) |
| IUPAC Name |
|---|
| N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide |
| INNs | Source |
|---|---|
| sulpirida | DrugBank |
| sulpiride | KEGG DRUG |
| sulpiridum | DrugBank |
| Synonyms | Source |
|---|---|
| 5-(Aminosulfonyl)-N-((1-ethyl-2-pyrrolidinyl)methyl)-2-methoxybenzamide | ChemIDplus |
| N-((1-Ethyl-2-pyrrolidinyl)methyl)-2-methoxy-5-sulfamoylbenzamide | ChemIDplus |
| N-((1-Ethyl-2-pyrrolidinyl)methyl)-5-sulfamoyl-o-anisamide | ChemIDplus |
| Sulpirid | DrugBank |
| (±)-sulpiride | NIST Chemistry WebBook |
| Sulpyrid | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:494008 | Reaxys |
| CAS:15676-16-1 | NIST Chemistry WebBook |
| CAS:15676-16-1 | KEGG DRUG |
| CAS:15676-16-1 | ChemIDplus |
| Citations |
|---|