EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O4 |
| Net Charge | -1 |
| Average Mass | 335.464 |
| Monoisotopic Mass | 335.22278 |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C/C=C/[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/p-1/b8-7+,9-6-,14-10+,15-11+/t18-,19+/m0/s1 |
| InChIKey | VNYSSYRCGWBHLG-CTOJTRLNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) is a leukotriene anion (CHEBI:62942) |
| Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) is a long-chain fatty acid anion (CHEBI:57560) |
| Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) is conjugate base of Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) |
| Incoming Relation(s) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) is conjugate acid of Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) |
| IUPAC Name |
|---|
| (5S,6E,10E,12E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| Synonyms | Source |
|---|---|
| (5S,12S)-dihydroxy-(6E,10E,12E,14Z)-icosapentaenoate | SUBMITTER |
| (5S,6E,10E,12E,12S,14Z)-5,12-dihydroxyicosatetraenoate | ChEBI |
| 12-epi-6-trans-LTB4(1−) | ChEBI |
| 12-epi-6-trans-leukotriene B4(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (5S,12S)-dihydroxy-(6E,10E,12E,14Z)-eicosatetraenoate | UniProt |
| Citations |
|---|