EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2O6.2Na |
| Net Charge | 0 |
| Average Mass | 346.206 |
| Monoisotopic Mass | 346.01777 |
| SMILES | O=C([O-])c1cc(N=Nc2ccc(O)c(C(=O)[O-])c2)ccc1O.[Na+].[Na+] |
| InChI | InChI=1S/C14H10N2O6.2Na/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22;;/h1-6,17-18H,(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | ZJEFYLVGGFISGT-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olsalazine sodium (CHEBI:63614) has part olsalazine(2−) (CHEBI:63719) |
| olsalazine sodium (CHEBI:63614) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| olsalazine sodium (CHEBI:63614) has role prodrug (CHEBI:50266) |
| olsalazine sodium (CHEBI:63614) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 3,3'-diazene-1,2-diylbis(6-hydroxybenzoate) |
| Synonyms | Source |
|---|---|
| disodium 3,3'-azobis (6-hydroxybenzoate) | ChEBI |
| Disodium 5,5'-azodisalicylate | ChemIDplus |
| Citations |
|---|