EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N5O4P |
| Net Charge | 0 |
| Average Mass | 287.216 |
| Monoisotopic Mass | 287.07834 |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O |
| InChI | InChI=1S/C9H14N5O4P/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17)/t6-/m1/s1 |
| InChIKey | SGOIRFVFHAKUTI-ZCFIWIBFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir (anhydrous) (CHEBI:63625) has role antiviral drug (CHEBI:36044) |
| tenofovir (anhydrous) (CHEBI:63625) has role drug metabolite (CHEBI:49103) |
| tenofovir (anhydrous) (CHEBI:63625) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| tenofovir (anhydrous) (CHEBI:63625) is a nucleoside analogue (CHEBI:60783) |
| tenofovir (anhydrous) (CHEBI:63625) is a phosphonic acids (CHEBI:26069) |
| tenofovir (anhydrous) (CHEBI:63625) is conjugate acid of tenofovir(1−) (CHEBI:134504) |
| Incoming Relation(s) |
| tenofovir disoproxil (CHEBI:63717) has functional parent tenofovir (anhydrous) (CHEBI:63625) |
| tenofovir hydrate (CHEBI:63716) has part tenofovir (anhydrous) (CHEBI:63625) |
| tenofovir(1−) (CHEBI:134504) is conjugate base of tenofovir (anhydrous) (CHEBI:63625) |
| IUPAC Name |
|---|
| ({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)phosphonic acid |
| INN | Source |
|---|---|
| tenofovir | ChemIDplus |
| Synonyms | Source |
|---|---|
| anh. tenofovir | ChEBI |
| anhydrous tenofovir | ChEBI |
| (R)-PMPA | ChEBI |
| tenofovir (anh.) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06074 | KEGG DRUG |
| DB00300 | DrugBank |
| HMDB0014445 | HMDB |
| LSM-5340 | LINCS |
| Tenofovir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7415378 | Reaxys |
| CAS:147127-20-6 | ChemIDplus |
| Citations |
|---|