EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N5O4P |
| Net Charge | -1 |
| Average Mass | 286.208 |
| Monoisotopic Mass | 286.07106 |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)([O-])O |
| InChI | InChI=1S/C9H14N5O4P/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17)/p-1/t6-/m1/s1 |
| InChIKey | SGOIRFVFHAKUTI-ZCFIWIBFSA-M |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir(1−) (CHEBI:134504) has role antiviral drug (CHEBI:36044) |
| tenofovir(1−) (CHEBI:134504) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| tenofovir(1−) (CHEBI:134504) is a phosphorus oxoanion (CHEBI:33461) |
| tenofovir(1−) (CHEBI:134504) is conjugate base of tenofovir (anhydrous) (CHEBI:63625) |
| Incoming Relation(s) |
| tenofovir (anhydrous) (CHEBI:63625) is conjugate acid of tenofovir(1−) (CHEBI:134504) |
| IUPAC Name |
|---|
| hydrogen ({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)phosphonate |
| Synonym | Source |
|---|---|
| tenofovir (1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| tenofovir | UniProt |
| Citations |
|---|