EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N5O4P.H2O |
| Net Charge | 0 |
| Average Mass | 305.231 |
| Monoisotopic Mass | 305.08891 |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O.O |
| InChI | InChI=1S/C9H14N5O4P.H2O/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14;/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17);1H2/t6-;/m1./s1 |
| InChIKey | PINIEAOMWQJGBW-FYZOBXCZSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir hydrate (CHEBI:63716) has part tenofovir (anhydrous) (CHEBI:63625) |
| tenofovir hydrate (CHEBI:63716) has role antiviral drug (CHEBI:36044) |
| tenofovir hydrate (CHEBI:63716) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| tenofovir hydrate (CHEBI:63716) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| ({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)phosphonic acid—water (1/1) |
| Synonyms | Source |
|---|---|
| tenofovir | ChemIDplus |
| tenofovir.H2O | ChEBI |
| tenofovir monohydrate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06074 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:206184-49-8 | ChemIDplus |