EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63580 - ribavirin
| Formula | C8H12N4O5 |
| Net Charge | 0 |
| Average Mass | 244.207 |
| Monoisotopic Mass | 244.08077 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | IWUCXVSUMQZMFG-AFCXAGJDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antifibrotic agent Any agent which acts to reduce fibrosis. hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin (CHEBI:63580) has functional parent 1,2,4-triazole-3-carboxamide (CHEBI:180482) |
| ribavirin (CHEBI:63580) has role anti-HBV agent (CHEBI:64951) |
| ribavirin (CHEBI:63580) has role anti-HIV agent (CHEBI:64946) |
| ribavirin (CHEBI:63580) has role anticoronaviral agent (CHEBI:149553) |
| ribavirin (CHEBI:63580) has role antidepressant (CHEBI:35469) |
| ribavirin (CHEBI:63580) has role antifibrotic agent (CHEBI:233423) |
| ribavirin (CHEBI:63580) has role antiinfective agent (CHEBI:35441) |
| ribavirin (CHEBI:63580) has role antimetabolite (CHEBI:35221) |
| ribavirin (CHEBI:63580) has role antineoplastic agent (CHEBI:35610) |
| ribavirin (CHEBI:63580) has role antiviral agent (CHEBI:22587) |
| ribavirin (CHEBI:63580) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| ribavirin (CHEBI:63580) has role hepatoprotective agent (CHEBI:62868) |
| ribavirin (CHEBI:63580) has role hypoglycemic agent (CHEBI:35526) |
| ribavirin (CHEBI:63580) is a 1-ribosyltriazole (CHEBI:63594) |
| ribavirin (CHEBI:63580) is a aromatic amide (CHEBI:62733) |
| ribavirin (CHEBI:63580) is a monocarboxylic acid amide (CHEBI:29347) |
| ribavirin (CHEBI:63580) is a primary carboxamide (CHEBI:140324) |
| Incoming Relation(s) |
| ribavirin 5'-diphosphate (CHEBI:180481) has functional parent ribavirin (CHEBI:63580) |
| ribavirin 5'-monophosphate (CHEBI:45490) has functional parent ribavirin (CHEBI:63580) |
| ribavirin 5'-triphosphate (CHEBI:45578) has functional parent ribavirin (CHEBI:63580) |
| IUPAC Name |
|---|
| 1-(β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide |
| INNs | Source |
|---|---|
| ribavirin | KEGG DRUG |
| ribavirina | DrugBank |
| ribavirine | DrugBank |
| ribavirinum | DrugBank |
| Synonyms | Source |
|---|---|
| 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamide | ChemIDplus |
| 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide | ChemIDplus |
| Cotronak | ChEMBL |
| NSC-163039 | ChEMBL |
| RBV | DrugBank |
| Ribavirin biopartners | ChEMBL |
| Brand Names | Source |
|---|---|
| Copegus | ChEMBL |
| Rebetol | ChEMBL |
| Ribapak | ChEMBL |
| Ribasphere | ChEMBL |
| Ribavirin mylan (previously ribavirin three rivers) | ChEMBL |
| Ribavirin teva pharma b.v. | ChEMBL |
| Citations |
|---|