EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N4O14P3 |
| Net Charge | 0 |
| Average Mass | 484.144 |
| Monoisotopic Mass | 483.97976 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H15N4O14P3/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(24-8)1-23-28(19,20)26-29(21,22)25-27(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H,19,20)(H,21,22)(H2,16,17,18)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | MMJOCKKLRMRSEQ-AFCXAGJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (30817703) | Found in red blood cells. |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a RNA-directed RNA polymerase (EC 2.7.7.48). human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. eukaryotic initiation factor 4F inhibitor Any compound that inihibits the mammalian protein, eukaryotic initiation factor 4F. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin 5'-triphosphate (CHEBI:45578) has functional parent ribavirin (CHEBI:63580) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role antiviral agent (CHEBI:22587) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role drug metabolite (CHEBI:49103) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor (CHEBI:170010) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role eukaryotic initiation factor 4F inhibitor (CHEBI:137079) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role human blood serum metabolite (CHEBI:85234) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a 1-ribosyltriazole (CHEBI:63594) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a aromatic amide (CHEBI:62733) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a monocarboxylic acid amide (CHEBI:29347) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a primary carboxamide (CHEBI:140324) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a ribose triphosphate (CHEBI:26563) |
| ribavirin 5'-triphosphate (CHEBI:45578) is conjugate acid of ribavirin 5'-triphosphate(4−) (CHEBI:189093) |
| Incoming Relation(s) |
| ribavirin 5'-triphosphate(4−) (CHEBI:189093) is conjugate base of ribavirin 5'-triphosphate (CHEBI:45578) |
| IUPAC Name |
|---|
| 1-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-β-D-ribofuranosyl]-1H-1,2,4-triazole-3-carboxamide |
| Synonyms | Source |
|---|---|
| 1-β-D-ribofuranosyl-1,2,4-triazole-3-carboxamide-5'-triphosphate | ChEBI |
| RBV-TP | ChEBI |
| ribavirin-TP | ChemIDplus |
| ribavirin triphosphate | PDBeChem |
| RTP | ChEBI |
| virazole 5'-triphosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 108908 | ChemSpider |
| HMDB0257207 | HMDB |
| RTP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:63142-71-2 | ChemIDplus |
| Citations |
|---|