EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N4O14P3 |
| Net Charge | 0 |
| Average Mass | 484.144 |
| Monoisotopic Mass | 483.97976 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H15N4O14P3/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(24-8)1-23-28(19,20)26-29(21,22)25-27(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H,19,20)(H,21,22)(H2,16,17,18)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | MMJOCKKLRMRSEQ-AFCXAGJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (30817703) | Found in red blood cells. |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a RNA-directed RNA polymerase (EC 2.7.7.48). eukaryotic initiation factor 4F inhibitor Any compound that inihibits the mammalian protein, eukaryotic initiation factor 4F. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin 5'-triphosphate (CHEBI:45578) has functional parent ribavirin (CHEBI:63580) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role antiviral agent (CHEBI:22587) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role drug metabolite (CHEBI:49103) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor (CHEBI:170010) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role eukaryotic initiation factor 4F inhibitor (CHEBI:137079) |
| ribavirin 5'-triphosphate (CHEBI:45578) has role human blood serum metabolite (CHEBI:85234) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a 1-ribosyltriazole (CHEBI:63594) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a aromatic amide (CHEBI:62733) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a monocarboxylic acid amide (CHEBI:29347) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a primary carboxamide (CHEBI:140324) |
| ribavirin 5'-triphosphate (CHEBI:45578) is a ribose triphosphate (CHEBI:26563) |
| ribavirin 5'-triphosphate (CHEBI:45578) is conjugate acid of ribavirin 5'-triphosphate(4−) (CHEBI:189093) |
| Incoming Relation(s) |
| ribavirin 5'-triphosphate(4−) (CHEBI:189093) is conjugate base of ribavirin 5'-triphosphate (CHEBI:45578) |
| IUPAC Name |
|---|
| 1-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-β-D-ribofuranosyl]-1H-1,2,4-triazole-3-carboxamide |
| Synonyms | Source |
|---|---|
| 1-β-D-ribofuranosyl-1,2,4-triazole-3-carboxamide-5'-triphosphate | ChEBI |
| RBV-TP | ChEBI |
| ribavirin-TP | ChemIDplus |
| ribavirin triphosphate | PDBeChem |
| RTP | ChEBI |
| virazole 5'-triphosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 108908 | ChemSpider |
| HMDB0257207 | HMDB |
| RTP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:63142-71-2 | ChemIDplus |
| Citations |
|---|