EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N4O8P |
| Net Charge | 0 |
| Average Mass | 324.186 |
| Monoisotopic Mass | 324.04710 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H13N4O8P/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(20-8)1-19-21(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H2,16,17,18)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | SDWIOXKHTFOULX-AFCXAGJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (25971261) | Found in red blood cells. |
| Simiiformes (ncbitaxon:314293) | blood (UBERON:0000178) | PubMed (17029670) | Found in monkey red blood cells. |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. EC 1.1.1.205 (IMP dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of IMP dehydrogenase (EC 1.1.1.205), so blocking de novo biosynthesis of purine nucleotides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin 5'-monophosphate (CHEBI:45490) has functional parent ribavirin (CHEBI:63580) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role antiviral agent (CHEBI:22587) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role drug metabolite (CHEBI:49103) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role EC 1.1.1.205 (IMP dehydrogenase) inhibitor (CHEBI:53746) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role human blood serum metabolite (CHEBI:85234) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a 1-ribosyltriazole (CHEBI:63594) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a aromatic amide (CHEBI:62733) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a monocarboxylic acid amide (CHEBI:29347) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a primary carboxamide (CHEBI:140324) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a ribose monophosphate (CHEBI:35159) |
| ribavirin 5'-monophosphate (CHEBI:45490) is conjugate acid of ribavirin 5'-monophosphate(2−) (CHEBI:189091) |
| Incoming Relation(s) |
| ribavirin 5'-monophosphate(2−) (CHEBI:189091) is conjugate base of ribavirin 5'-monophosphate (CHEBI:45490) |
| IUPAC Name |
|---|
| 1-(5-O-phosphono-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide |
| Synonyms | Source |
|---|---|
| ICN 3847 | ChemIDplus |
| RBV-MP | ChEBI |
| ribavirin-5'-phosphate | ChemIDplus |
| ribavirin monophosphate | ChemIDplus |
| ribavirin-MP | ChEBI |
| RMP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 90600 | ChemSpider |
| DB14663 | DrugBank |
| HMDB0257208 | HMDB |
| RVP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:40925-28-8 | ChemIDplus |
| Citations |
|---|