EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N4O8P |
| Net Charge | 0 |
| Average Mass | 324.186 |
| Monoisotopic Mass | 324.04710 |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H13N4O8P/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(20-8)1-19-21(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H2,16,17,18)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | SDWIOXKHTFOULX-AFCXAGJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (25971261) | Found in red blood cells. |
| Simiiformes (ncbitaxon:314293) | blood (UBERON:0000178) | PubMed (17029670) | Found in monkey red blood cells. |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. antiviral agent A substance that destroys or inhibits replication of viruses. EC 1.1.1.205 (IMP dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of IMP dehydrogenase (EC 1.1.1.205), so blocking de novo biosynthesis of purine nucleotides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribavirin 5'-monophosphate (CHEBI:45490) has functional parent ribavirin (CHEBI:63580) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role antiviral agent (CHEBI:22587) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role drug metabolite (CHEBI:49103) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role EC 1.1.1.205 (IMP dehydrogenase) inhibitor (CHEBI:53746) |
| ribavirin 5'-monophosphate (CHEBI:45490) has role human blood serum metabolite (CHEBI:85234) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a 1-ribosyltriazole (CHEBI:63594) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a aromatic amide (CHEBI:62733) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a monocarboxylic acid amide (CHEBI:29347) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a primary carboxamide (CHEBI:140324) |
| ribavirin 5'-monophosphate (CHEBI:45490) is a ribose monophosphate (CHEBI:35159) |
| ribavirin 5'-monophosphate (CHEBI:45490) is conjugate acid of ribavirin 5'-monophosphate(2−) (CHEBI:189091) |
| Incoming Relation(s) |
| ribavirin 5'-monophosphate(2−) (CHEBI:189091) is conjugate base of ribavirin 5'-monophosphate (CHEBI:45490) |
| IUPAC Name |
|---|
| 1-(5-O-phosphono-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide |
| Synonyms | Source |
|---|---|
| ICN 3847 | ChemIDplus |
| RBV-MP | ChEBI |
| ribavirin-5'-phosphate | ChemIDplus |
| ribavirin monophosphate | ChemIDplus |
| ribavirin-MP | ChEBI |
| RMP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 90600 | ChemSpider |
| DB14663 | DrugBank |
| HMDB0257208 | HMDB |
| RVP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:40925-28-8 | ChemIDplus |
| Citations |
|---|