EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O9S |
| Net Charge | 0 |
| Average Mass | 256.188 |
| Monoisotopic Mass | 255.98890 |
| SMILES | [H]C(=O)[C@H](OS(=O)(=O)O)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O9S/c7-2-5(15-16(12,13)14)3(8)1-4(9)6(10)11/h2-3,5,8H,1H2,(H,10,11)(H,12,13,14)/t3-,5-/m0/s1 |
| InChIKey | WFKZEQZRFIPKIF-UCORVYFPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) has functional parent 5-dehydro-4-deoxy-D-glucuronic acid (CHEBI:17782) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) is a aldehyde (CHEBI:17478) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) is a carbohydrate sulfate (CHEBI:35724) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) is a monocarboxylic acid (CHEBI:25384) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) is conjugate acid of 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) |
| Incoming Relation(s) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) is conjugate base of 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) |
| IUPAC Name |
|---|
| 4-deoxy-2-O-sulfo-L-threo-hex-5-ulosuronic acid |