EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O9S |
| Net Charge | -2 |
| Average Mass | 254.172 |
| Monoisotopic Mass | 253.97435 |
| SMILES | [H]C(=O)[C@H](OS(=O)(=O)[O-])[C@@H](O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O9S/c7-2-5(15-16(12,13)14)3(8)1-4(9)6(10)11/h2-3,5,8H,1H2,(H,10,11)(H,12,13,14)/p-2/t3-,5-/m0/s1 |
| InChIKey | WFKZEQZRFIPKIF-UCORVYFPSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) is a carbohydrate acid derivative anion (CHEBI:63551) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) is a monocarboxylic acid anion (CHEBI:35757) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) is a organosulfate oxoanion (CHEBI:58958) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) is conjugate base of 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) |
| Incoming Relation(s) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) is conjugate acid of 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid(2−) (CHEBI:63278) |
| IUPAC Name |
|---|
| 4-deoxy-2-O-sulfonato-L-threo-hex-5-ulosuronate |
| UniProt Name | Source |
|---|---|
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronate | UniProt |