EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | [H]C(=O)[C@H](O)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h2-3,5,8,10H,1H2,(H,11,12)/t3-,5-/m0/s1 |
| InChIKey | IMUGYKFHMJLTOU-UCORVYFPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-dehydro-4-deoxy-D-glucuronic acid (CHEBI:17782) is a aldehyde (CHEBI:17478) |
| 5-dehydro-4-deoxy-D-glucuronic acid (CHEBI:17782) is a hexuronic acid (CHEBI:24592) |
| 5-dehydro-4-deoxy-D-glucuronic acid (CHEBI:17782) is conjugate acid of 5-dehydro-4-deoxy-D-glucuronate (CHEBI:17117) |
| Incoming Relation(s) |
| 5-dehydro-4-deoxy-2-O-sulfo-D-glucuronic acid (CHEBI:63275) has functional parent 5-dehydro-4-deoxy-D-glucuronic acid (CHEBI:17782) |
| 5-dehydro-4-deoxy-D-glucuronate (CHEBI:17117) is conjugate base of 5-dehydro-4-deoxy-D-glucuronic acid (CHEBI:17782) |
| IUPAC Name |
|---|
| 4-deoxy-L-threo-hex-5-ulosuronic acid |
| Synonym | Source |
|---|---|
| 4-deoxy-L-threo-5-hexulosuronic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04053 | KEGG COMPOUND |
| Citations |
|---|