EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N2O4 |
| Net Charge | +1 |
| Average Mass | 345.419 |
| Monoisotopic Mass | 345.18088 |
| SMILES | [H]C(=O)Nc1cc([C@H](O)C[NH2+][C@@H](C)Cc2ccc(OC)cc2)ccc1O |
| InChI | InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/p+1/t13-,19+/m0/s1 |
| InChIKey | BPZSYCZIITTYBL-ORAYPTAESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-formoterol(1+) (CHEBI:63110) is a ammonium ion derivative (CHEBI:35274) |
| (S,S)-formoterol(1+) (CHEBI:63110) is a organic cation (CHEBI:25697) |
| (S,S)-formoterol(1+) (CHEBI:63110) is conjugate acid of (S,S)-formoterol (CHEBI:63081) |
| (S,S)-formoterol(1+) (CHEBI:63110) is enantiomer of arformoterol(1+) (CHEBI:63107) |
| Incoming Relation(s) |
| (S,S)-formoterol fumarate (CHEBI:63109) has part (S,S)-formoterol(1+) (CHEBI:63110) |
| formoterol(1+) (CHEBI:63111) has part (S,S)-formoterol(1+) (CHEBI:63110) |
| (S,S)-formoterol (CHEBI:63081) is conjugate base of (S,S)-formoterol(1+) (CHEBI:63110) |
| arformoterol(1+) (CHEBI:63107) is enantiomer of (S,S)-formoterol(1+) (CHEBI:63110) |
| IUPAC Name |
|---|
| (2S)-N-{(2S)-2-[3-(formylamino)-4-hydroxyphenyl]-2-hydroxyethyl}-1-(4-methoxyphenyl)propan-2-aminium |
| Synonym | Source |
|---|---|
| (+)-formoterol(1+) | ChEBI |