EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O4 |
| Net Charge | 0 |
| Average Mass | 344.411 |
| Monoisotopic Mass | 344.17361 |
| SMILES | [H]C(=O)Nc1cc([C@H](O)CN[C@@H](C)Cc2ccc(OC)cc2)ccc1O |
| InChI | InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m0/s1 |
| InChIKey | BPZSYCZIITTYBL-ORAYPTAESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-formoterol (CHEBI:63081) is a N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide (CHEBI:63082) |
| (S,S)-formoterol (CHEBI:63081) is conjugate base of (S,S)-formoterol(1+) (CHEBI:63110) |
| (S,S)-formoterol (CHEBI:63081) is enantiomer of arformoterol (CHEBI:408174) |
| Incoming Relation(s) |
| formoterol (CHEBI:5147) has part (S,S)-formoterol (CHEBI:63081) |
| (S,S)-formoterol(1+) (CHEBI:63110) is conjugate acid of (S,S)-formoterol (CHEBI:63081) |
| arformoterol (CHEBI:408174) is enantiomer of (S,S)-formoterol (CHEBI:63081) |
| IUPAC Name |
|---|
| N-{2-hydroxy-5-[(1S)-1-hydroxy-2-{[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide |
| Synonyms | Source |
|---|---|
| (+)-formoterol | ChEBI |
| (S,S)-N-[2-hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formaldehyde | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-4251 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7861826 | Reaxys |