EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C19H24N2O4.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 804.894 |
| Monoisotopic Mass | 804.35817 |
| SMILES | O=C(O)/C=C/C(=O)O.[H]C(=O)Nc1cc([C@H](O)CN[C@@H](C)Cc2ccc(OC)cc2)ccc1O.[H]C(=O)Nc1cc([C@H](O)CN[C@@H](C)Cc2ccc(OC)cc2)ccc1O |
| InChI | InChI=1S/2C19H24N2O4.C4H4O4/c2*1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22;5-3(6)1-2-4(7)8/h2*3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22);1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*13-,19+;/m00./s1 |
| InChIKey | OBRNDARFFFHCGE-PERKLWIXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-formoterol fumarate (CHEBI:63109) has part (S,S)-formoterol(1+) (CHEBI:63110) |
| (S,S)-formoterol fumarate (CHEBI:63109) is a fumarate salt (CHEBI:50921) |
| (S,S)-formoterol fumarate (CHEBI:63109) is enantiomer of arformoterol fumarate (CHEBI:63108) |
| Incoming Relation(s) |
| formoterol fumarate (CHEBI:31633) has part (S,S)-formoterol fumarate (CHEBI:63109) |
| arformoterol fumarate (CHEBI:63108) is enantiomer of (S,S)-formoterol fumarate (CHEBI:63109) |
| IUPAC Name |
|---|
| bis[(2S)-N-{(2S)-2-[3-(formylamino)-4-hydroxyphenyl]-2-hydroxyethyl}-1-(4-methoxyphenyl)propan-2-aminium] (2E)-but-2-enedioate |
| Synonym | Source |
|---|---|
| N-{2-hydroxy-5-[(1S)-1-hydroxy-2-{[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide (2E)-but-2-enedioate | IUPAC |