EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S |
| Net Charge | 0 |
| Average Mass | 236.293 |
| Monoisotopic Mass | 236.08308 |
| SMILES | [NH3+][C@@H](CCSCC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H16N2O4S/c9-5(7(11)12)1-3-15-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | MBEPFGPQVBIIES-WDSKDSINSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homolanthionine dizwitterion (CHEBI:178194) has functional parent L-homocysteine zwitterion (CHEBI:58199) |
| L-homolanthionine dizwitterion (CHEBI:178194) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-homolanthionine dizwitterion (CHEBI:178194) is tautomer of L-homolanthionine (CHEBI:62856) |
| Incoming Relation(s) |
| L-homolanthionine (CHEBI:62856) is tautomer of L-homolanthionine dizwitterion (CHEBI:178194) |
| IUPAC Name |
|---|
| (2S,2'S)-4,4'-sulfanediylbis(2-azaniumylbutanoate) |
| Synonyms | Source |
|---|---|
| homolanthionine dizwitterion | ChEBI |
| L-homolanthionine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-homolanthionine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD66-96 | MetaCyc |
| Citations |
|---|