EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 132.163 |
| Monoisotopic Mass | 132.08988 |
| SMILES | NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | AHLPHDHHMVZTML-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ornithine (CHEBI:15729) has role algal metabolite (CHEBI:84735) |
| L-ornithine (CHEBI:15729) has role hepatoprotective agent (CHEBI:62868) |
| L-ornithine (CHEBI:15729) has role mouse metabolite (CHEBI:75771) |
| L-ornithine (CHEBI:15729) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-ornithine (CHEBI:15729) is a ornithine (CHEBI:18257) |
| L-ornithine (CHEBI:15729) is conjugate acid of L-ornithinate (CHEBI:46914) |
| L-ornithine (CHEBI:15729) is conjugate base of L-ornithinium(1+) (CHEBI:46911) |
| L-ornithine (CHEBI:15729) is enantiomer of D-ornithine (CHEBI:16176) |
| Incoming Relation(s) |
| L-Orn-D-Asp (CHEBI:144746) has functional parent L-ornithine (CHEBI:15729) |
| L-Orn-D-Glu (CHEBI:144747) has functional parent L-ornithine (CHEBI:15729) |
| L-ornithine derivative (CHEBI:21368) has functional parent L-ornithine (CHEBI:15729) |
| sinefungin (CHEBI:45453) has functional parent L-ornithine (CHEBI:15729) |
| L-ornithine-d6 (CHEBI:192081) is a L-ornithine (CHEBI:15729) |
| L-ornithinium(1+) (CHEBI:46911) is conjugate acid of L-ornithine (CHEBI:15729) |
| L-ornithinate (CHEBI:46914) is conjugate base of L-ornithine (CHEBI:15729) |
| D-ornithine (CHEBI:16176) is enantiomer of L-ornithine (CHEBI:15729) |
| N2-L-ornithino group (CHEBI:44548) is substituent group from L-ornithine (CHEBI:15729) |
| N5-L-ornithino group (CHEBI:46935) is substituent group from L-ornithine (CHEBI:15729) |
| L-ornithine residue (CHEBI:44571) is substituent group from L-ornithine (CHEBI:15729) |
| L-ornithyl group (CHEBI:44700) is substituent group from L-ornithine (CHEBI:15729) |
| IUPAC Names |
|---|
| (2S)-2,5-diaminopentanoic acid |
| L-ornithine |
| Synonyms | Source |
|---|---|
| (S)-ornithine | ChemIDplus |
| (S)-α,δ-diaminovaleric acid | HMDB |
| L-ornithine | ChEBI |
| L-Ornithine | KEGG COMPOUND |
| (S)-2,5-Diaminopentanoate | KEGG COMPOUND |
| (S)-2,5-Diaminopentanoic acid | KEGG COMPOUND |
| Citations |
|---|