EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6D6N2O2 |
| Net Charge | 0 |
| Average Mass | 138.200 |
| Monoisotopic Mass | 138.12754 |
| SMILES | [2H]C([2H])(N)C([2H])([2H])C([2H])([2H])[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1/i1D2,2D2,3D2 |
| InChIKey | AHLPHDHHMVZTML-UJSKYATRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ornithine-d6 (CHEBI:192081) is a L-ornithine (CHEBI:15729) |
| L-ornithine-d6 (CHEBI:192081) is a deuterated compound (CHEBI:76107) |