EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N2O2 |
| Net Charge | -1 |
| Average Mass | 131.155 |
| Monoisotopic Mass | 131.08260 |
| SMILES | NCCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p-1/t4-/m0/s1 |
| InChIKey | AHLPHDHHMVZTML-BYPYZUCNSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ornithinate (CHEBI:46914) has role human metabolite (CHEBI:77746) |
| L-ornithinate (CHEBI:46914) is a L-α-amino acid anion (CHEBI:59814) |
| L-ornithinate (CHEBI:46914) is a ornithinate (CHEBI:32964) |
| L-ornithinate (CHEBI:46914) is conjugate base of L-ornithine (CHEBI:15729) |
| Incoming Relation(s) |
| N2,N5-dibenzoyl-L-ornithinate (CHEBI:57722) has functional parent L-ornithinate (CHEBI:46914) |
| L-ornithine (CHEBI:15729) is conjugate acid of L-ornithinate (CHEBI:46914) |
| IUPAC Names |
|---|
| L-ornithinate |
| (2S)-2,5-diaminopentanoate |
| Synonym | Source |
|---|---|
| L-ornithine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:327281 | Gmelin |