EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N7O5 |
| Net Charge | 0 |
| Average Mass | 381.393 |
| Monoisotopic Mass | 381.17607 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C[C@@H](N)CC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23N7O5/c16-6(1-2-7(17)15(25)26)3-8-10(23)11(24)14(27-8)22-5-21-9-12(18)19-4-20-13(9)22/h4-8,10-11,14,23-24H,1-3,16-17H2,(H,25,26)(H2,18,19,20)/t6-,7-,8+,10+,11+,14+/m0/s1 |
| InChIKey | LMXOHSDXUQEUSF-YECHIGJVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinefungin (CHEBI:45453) has functional parent L-ornithine (CHEBI:15729) |
| sinefungin (CHEBI:45453) has role antifungal agent (CHEBI:35718) |
| sinefungin (CHEBI:45453) has role antimicrobial agent (CHEBI:33281) |
| sinefungin (CHEBI:45453) is a adenosines (CHEBI:22260) |
| sinefungin (CHEBI:45453) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (5S)-5-amino-6-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]-L-norleucine |
| INNs | Source |
|---|---|
| sinefungin | KEGG DRUG |
| sinefungina | ChemIDplus |
| sinefungine | ChemIDplus |
| sinefunginum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5S)-2,5-diamino-6-[(2R,3S,R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]hexanoic acid | PDBeChem |
| 6,9-Diamino-1-(6-amino-9H-purin-9-yl)-1,5,6,7,8,9-hexadeoxy-beta-D-ribo-decofuranuronic acid | ChemIDplus |
| 6,9-Diamino-1-(6-amino-9H-purin-9-yl)-1,5,6,7,8,9-hexadeoxydecofuranuronic acid | ChemIDplus |
| A 9145 | ChemIDplus |
| ADENOSYL-ORNITHINE | PDBeChem |
| Antibiotic A 9145 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05846 | KEGG DRUG |
| SFG | PDBeChem |
| SINEFUNGIN | MetaCyc |
| US3758681 | Patent |
| US5872104 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3574678 | Reaxys |
| CAS:58944-73-3 | KEGG DRUG |
| CAS:58944-73-3 | ChemIDplus |
| Citations |
|---|