EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=CCCC1(C)C2CC=C(C)C1C2 |
| InChI | InChI=1S/C15H24/c1-11(2)6-5-9-15(4)13-8-7-12(3)14(15)10-13/h6-7,13-14H,5,8-10H2,1-4H3 |
| InChIKey | YMBFCQPIMVLNIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-bergamotene (CHEBI:62755) has role plant metabolite (CHEBI:76924) |
| α-bergamotene (CHEBI:62755) has role volatile oil component (CHEBI:27311) |
| α-bergamotene (CHEBI:62755) is a bridged compound (CHEBI:35990) |
| α-bergamotene (CHEBI:62755) is a polycyclic olefin (CHEBI:35714) |
| α-bergamotene (CHEBI:62755) is a sesquiterpene (CHEBI:35189) |
| Incoming Relation(s) |
| α-bergamotenoic acid (CHEBI:131505) has functional parent α-bergamotene (CHEBI:62755) |
| (−)-exo-α-bergamotene (CHEBI:62756) is a α-bergamotene (CHEBI:62755) |
| cis-α-bergamotene (CHEBI:176809) is a α-bergamotene (CHEBI:62755) |
| IUPAC Name |
|---|
| 2,6-dimethyl-6-(4-methylpent-3-en-1-yl)bicyclo[3.1.1]hept-2-ene |
| Manual Xrefs | Databases |
|---|---|
| C00048311 | KNApSAcK |
| C17088 | KEGG COMPOUND |
| HMDB0036678 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:17699-05-7 | KEGG COMPOUND |
| Citations |
|---|