EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | CC1=CCC2CC1C2(C)CC/C=C(/C)C(=O)O |
| InChI | InChI=1S/C15H22O2/c1-10-6-7-12-9-13(10)15(12,3)8-4-5-11(2)14(16)17/h5-6,12-13H,4,7-9H2,1-3H3,(H,16,17)/b11-5- |
| InChIKey | CTORLPNPQPAKGI-WZUFQYTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum habrochaites (ncbitaxon:62890) | - | MetaboLights (MTBLS297) | |
| Solanum lycopersicum (ncbitaxon:4081) | - | MetaboLights (MTBLS297) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-bergamotenoic acid (CHEBI:131505) has functional parent α-bergamotene (CHEBI:62755) |
| α-bergamotenoic acid (CHEBI:131505) has role insecticide (CHEBI:24852) |
| α-bergamotenoic acid (CHEBI:131505) has role plant metabolite (CHEBI:76924) |
| α-bergamotenoic acid (CHEBI:131505) is a bridged compound (CHEBI:35990) |
| α-bergamotenoic acid (CHEBI:131505) is a sesquiterpenoid (CHEBI:26658) |
| α-bergamotenoic acid (CHEBI:131505) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2Z)-5-(2,6-dimethylbicyclo[3.1.1]hept-2-en-6-yl)-2-methylpent-2-enoic acid |
| Synonym | Source |
|---|---|
| (Z)-α-bergamotenoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 35014137 | ChemSpider |
| HMDB0036392 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:124439-27-6 | HMDB |