EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=CCC[C@]1(C)[C@H]2CC=C(C)[C@@H]1C2 |
| InChI | InChI=1S/C15H24/c1-11(2)6-5-9-15(4)13-8-7-12(3)14(15)10-13/h6-7,13-14H,5,8-10H2,1-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | YMBFCQPIMVLNIU-SOUVJXGZSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-exo-α-bergamotene (CHEBI:62756) is a α-bergamotene (CHEBI:62755) |
| IUPAC Name |
|---|
| (1S,5S,6R)-2,6-dimethyl-6-(4-methylpent-3-en-1-yl)bicyclo[3.1.1]hept-2-ene |
| Synonym | Source |
|---|---|
| (−)-trans-α-bergamotene | ChEBI |
| UniProt Name | Source |
|---|---|
| (1S,5S,6R)-α-bergamotene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2207726 | Reaxys |
| Citations |
|---|