EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O6 |
| Net Charge | 0 |
| Average Mass | 166.129 |
| Monoisotopic Mass | 166.04774 |
| SMILES | O=C(O)[C@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A221h]/1/ |
| InChI | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4+/m0/s1 |
| InChIKey | QXKAIJAYHKCRRA-PZGQECOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (949837) | |
| Rattus norvegicus (ncbitaxon:10116) | kidney (BTO:0000671) | PubMed (14404302) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lyxonic acid (CHEBI:6268) has role human urinary metabolite (CHEBI:84087) |
| L-lyxonic acid (CHEBI:6268) has role rat metabolite (CHEBI:86264) |
| L-lyxonic acid (CHEBI:6268) is a lyxonic acid (CHEBI:145755) |
| L-lyxonic acid (CHEBI:6268) is conjugate acid of L-lyxonate (CHEBI:145753) |
| L-lyxonic acid (CHEBI:6268) is enantiomer of D-lyxonic acid (CHEBI:134538) |
| Incoming Relation(s) |
| L-lyxonate (CHEBI:145753) is conjugate base of L-lyxonic acid (CHEBI:6268) |
| D-lyxonic acid (CHEBI:134538) is enantiomer of L-lyxonic acid (CHEBI:6268) |
| IUPAC Name |
|---|
| L-lyxonic acid |
| Synonym | Source |
|---|---|
| (2R,3R,4S)-2,3,4,5-tetrahydroxypentanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C05412 | KEGG COMPOUND |
| HMDB0060255 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:4172-43-4 | ChEBI |
| Citations |
|---|