EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O6 |
| Net Charge | 0 |
| Average Mass | 166.129 |
| Monoisotopic Mass | 166.04774 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A112h]/1/ |
| InChI | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4+/m1/s1 |
| InChIKey | QXKAIJAYHKCRRA-UZBSEBFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS355) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-lyxonic acid (CHEBI:134538) has role plant metabolite (CHEBI:76924) |
| D-lyxonic acid (CHEBI:134538) is a lyxonic acid (CHEBI:145755) |
| D-lyxonic acid (CHEBI:134538) is conjugate acid of D-lyxonate (CHEBI:145758) |
| D-lyxonic acid (CHEBI:134538) is enantiomer of L-lyxonic acid (CHEBI:6268) |
| Incoming Relation(s) |
| D-lyxono-1,4-lactone (CHEBI:134539) has functional parent D-lyxonic acid (CHEBI:134538) |
| D-lyxonate (CHEBI:145758) is conjugate base of D-lyxonic acid (CHEBI:134538) |
| L-lyxonic acid (CHEBI:6268) is enantiomer of D-lyxonic acid (CHEBI:134538) |
| IUPAC Name |
|---|
| D-lyxonic acid |
| Synonyms | Source |
|---|---|
| (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoic acid | IUPAC |
| Lyxonic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 134810 | ChemSpider |
| CN1602762 | Patent |
| CPD-8902 | MetaCyc |
| GB2403220 | Patent |
| US2004131737 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724266 | Reaxys |
| CAS:28223-40-7 | ChemIDplus |
| Citations |
|---|