EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O6 |
| Net Charge | -1 |
| Average Mass | 165.121 |
| Monoisotopic Mass | 165.04046 |
| SMILES | O=C([O-])[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3+,4+/m0/s1 |
| InChIKey | QXKAIJAYHKCRRA-PZGQECOJSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lyxonate (CHEBI:145753) has role metabolite (CHEBI:25212) |
| L-lyxonate (CHEBI:145753) is a lyxonate (CHEBI:145756) |
| L-lyxonate (CHEBI:145753) is conjugate base of L-lyxonic acid (CHEBI:6268) |
| L-lyxonate (CHEBI:145753) is enantiomer of D-lyxonate (CHEBI:145758) |
| Incoming Relation(s) |
| 2-carboxy-L-lyxonate (CHEBI:149765) has functional parent L-lyxonate (CHEBI:145753) |
| L-lyxonic acid (CHEBI:6268) is conjugate acid of L-lyxonate (CHEBI:145753) |
| D-lyxonate (CHEBI:145758) is enantiomer of L-lyxonate (CHEBI:145753) |
| IUPAC Name |
|---|
| L-lyxonate |
| Synonym | Source |
|---|---|
| (2R,3R,4S)-2,3,4,5-tetrahydroxypentanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| L-lyxonate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1198 | MetaCyc |
| Citations |
|---|