EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2Se |
| Net Charge | 0 |
| Average Mass | 196.108 |
| Monoisotopic Mass | 196.99550 |
| SMILES | C[Se]CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | RJFAYQIBOAGBLC-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenomethionine zwitterion (CHEBI:62621) has role plant metabolite (CHEBI:76924) |
| L-selenomethionine zwitterion (CHEBI:62621) is a amino-acid zwitterion (CHEBI:35238) |
| L-selenomethionine zwitterion (CHEBI:62621) is tautomer of L-selenomethionine (CHEBI:30021) |
| Incoming Relation(s) |
| Se-methyl-L-selenomethionine(1+) (CHEBI:143861) has functional parent L-selenomethionine zwitterion (CHEBI:62621) |
| L-selenomethionine (CHEBI:30021) is tautomer of L-selenomethionine zwitterion (CHEBI:62621) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-(methylselanyl)butanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-4-(methylselanyl)butanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| L-selenomethionine | UniProt |