EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO2Se |
| Net Charge | +1 |
| Average Mass | 211.143 |
| Monoisotopic Mass | 212.01843 |
| SMILES | C[Se+](C)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2Se/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/p+1/t5-/m0/s1 |
| InChIKey | QALHNGMTIIHGNI-YFKPBYRVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methyl-L-selenomethionine(1+) (CHEBI:143861) has functional parent L-selenomethionine zwitterion (CHEBI:62621) |
| Se-methyl-L-selenomethionine(1+) (CHEBI:143861) is a α-amino-acid cation (CHEBI:33719) |
| Se-methyl-L-selenomethionine(1+) (CHEBI:143861) is tautomer of Se-methyl-L-selenomethionine (CHEBI:28513) |
| Incoming Relation(s) |
| Se-methyl-L-selenomethionine (CHEBI:28513) is tautomer of Se-methyl-L-selenomethionine(1+) (CHEBI:143861) |
| Synonyms | Source |
|---|---|
| Se-methyl-Se-L-methionine(1+) | SUBMITTER |
| selenium-methyl-selenium-L-methionine(1+) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| Se-methyl-L-selenomethionine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12025 | MetaCyc |
| Citations |
|---|