EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2Se |
| Net Charge | 0 |
| Average Mass | 196.108 |
| Monoisotopic Mass | 196.99550 |
| SMILES | C[Se]CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | RJFAYQIBOAGBLC-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenomethionine (CHEBI:30021) is a selenomethionine (CHEBI:27585) |
| L-selenomethionine (CHEBI:30021) is enantiomer of D-selenomethionine (CHEBI:30022) |
| L-selenomethionine (CHEBI:30021) is tautomer of L-selenomethionine zwitterion (CHEBI:62621) |
| Incoming Relation(s) |
| L-adenosylselenohomocysteine (CHEBI:77028) has functional parent L-selenomethionine (CHEBI:30021) |
| D-selenomethionine (CHEBI:30022) is enantiomer of L-selenomethionine (CHEBI:30021) |
| L-selenomethionine residue (CHEBI:30019) is substituent group from L-selenomethionine (CHEBI:30021) |
| L-selenomethionine zwitterion (CHEBI:62621) is tautomer of L-selenomethionine (CHEBI:30021) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(methylseleno)butanoic acid |
| Synonym | Source |
|---|---|
| L-selenomethionine | JCBN |
| Manual Xrefs | Databases |
|---|---|
| 3544 | DrugCentral |
| C05335 | KEGG COMPOUND |
| HMDB0003966 | HMDB |
| MSE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:3211-76-5 | KEGG COMPOUND |
| Citations |
|---|