EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15O9 |
| Net Charge | -1 |
| Average Mass | 267.210 |
| Monoisotopic Mass | 267.07216 |
| SMILES | O=C([O-])[C@@H](CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O9/c10-1-3-5(12)6(13)7(14)9(17-3)18-4(2-11)8(15)16/h3-7,9-14H,1-2H2,(H,15,16)/p-1/t3-,4-,5-,6+,7-,9-/m1/s1 |
| InChIKey | DDXCFDOPXBPUJC-CECBSOHTSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-(α-D-glucopyranosyl)-D-glycerate (CHEBI:62510) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 2-O-(α-D-glucopyranosyl)-D-glycerate (CHEBI:62510) is a α-D-glucoside (CHEBI:22390) |
| 2-O-(α-D-glucopyranosyl)-D-glycerate (CHEBI:62510) is conjugate base of 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) |
| Incoming Relation(s) |
| 2-O-(α-D-glucopyranosyl)-D-glyceric acid (CHEBI:62509) is conjugate acid of 2-O-(α-D-glucopyranosyl)-D-glycerate (CHEBI:62510) |
| IUPAC Name |
|---|
| (2R)-2-(α-D-glucopyranosyloxy)-3-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| O-α-D-glucopyranosyl-(1→2)-D-glycerate | ChEBI |
| (R)-2-O-α-D-glucopyranosyl glycerate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2R)-2-O-(α-D-glucopyranosyl)-glycerate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9190 | MetaCyc |
| Citations |
|---|