EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19O7P2 |
| Net Charge | -3 |
| Average Mass | 325.214 |
| Monoisotopic Mass | 325.06225 |
| SMILES | CC(C)=CCC/C(C)=C(\C)COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C11H22O7P2/c1-9(2)6-5-7-10(3)11(4)8-17-20(15,16)18-19(12,13)14/h6H,5,7-8H2,1-4H3,(H,15,16)(H2,12,13,14)/p-3/b11-10+ |
| InChIKey | PRUWPPRJQIGKNB-ZHACJKMWSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-methylgeranyl diphosphate(3−) (CHEBI:61984) is a organophosphate oxoanion (CHEBI:58945) |
| (E)-2-methylgeranyl diphosphate(3−) (CHEBI:61984) is conjugate base of (E)-2-methylgeranyl diphosphate (CHEBI:61982) |
| Incoming Relation(s) |
| (E)-2-methylgeranyl diphosphate (CHEBI:61982) is conjugate acid of (E)-2-methylgeranyl diphosphate(3−) (CHEBI:61984) |
| Synonyms | Source |
|---|---|
| (E)-2-methylgeranyl diphosphate | ChEBI |
| (E)-2-methylgeranyl diphosphate trianion | ChEBI |
| (E)-2-methylgeranyl pyrophosphate | ChEBI |
| (E)-2-methylgeranyl pyrophosphate(3−) | ChEBI |
| (E)-2-methylgeranyl pyrophosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| (E)-2-methylgeranyl diphosphate | UniProt |
| Citations |
|---|