EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO6 |
| Net Charge | 0 |
| Average Mass | 189.123 |
| Monoisotopic Mass | 189.02734 |
| SMILES | *N[C@@H](CC(C(=O)O)C(=O)O)C(=O)O* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-carboxy-L-glutamic acid residue (CHEBI:61939) is a L-α-amino acid residue (CHEBI:83228) |
| γ-carboxy-L-glutamic acid residue (CHEBI:61939) is conjugate acid of γ-carboxy-L-glutamate(2−) residue (CHEBI:84990) |
| γ-carboxy-L-glutamic acid residue (CHEBI:61939) is conjugate acid of γ-carboxy-L-glutamic acid(2−) residue (CHEBI:61941) |
| γ-carboxy-L-glutamic acid residue (CHEBI:61939) is substituent group from γ-carboxy-L-glutamic acid (CHEBI:41450) |
| Incoming Relation(s) |
| γ-carboxy-L-glutamate(2−) residue (CHEBI:84990) is conjugate base of γ-carboxy-L-glutamic acid residue (CHEBI:61939) |
| γ-carboxy-L-glutamic acid(2−) residue (CHEBI:61941) is conjugate base of γ-carboxy-L-glutamic acid residue (CHEBI:61939) |