EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO6 |
| Net Charge | 0 |
| Average Mass | 191.139 |
| Monoisotopic Mass | 191.04299 |
| SMILES | N[C@@H](CC(C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1 |
| InChIKey | UHBYWPGGCSDKFX-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-carboxy-L-glutamic acid (CHEBI:41450) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| γ-carboxy-L-glutamic acid (CHEBI:41450) is a tricarboxylic acid (CHEBI:27093) |
| γ-carboxy-L-glutamic acid (CHEBI:41450) is tautomer of γ-carboxy-L-glutamic acid zwitterion (CHEBI:61936) |
| Incoming Relation(s) |
| γ-carboxy-L-glutamic acid residue (CHEBI:61939) is substituent group from γ-carboxy-L-glutamic acid (CHEBI:41450) |
| γ-carboxy-L-glutamic acid zwitterion (CHEBI:61936) is tautomer of γ-carboxy-L-glutamic acid (CHEBI:41450) |
| IUPAC Name |
|---|
| (3S)-3-aminopropane-1,1,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| (3S)-3-amino-1,1,3-propanetricarboxylic acid | ChEBI |
| GAMMA-CARBOXY-GLUTAMIC ACID | PDBeChem |
| gamma-carboxy-glutamic acid zwitterion | ChEBI |
| Gla | ChEBI |
| H-L-Gla-OH | ChEBI |
| L-Gla-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CGU | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2417114 | Reaxys |
| CAS:53861-57-7 | ChemIDplus |