EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO6 |
| Net Charge | -2 |
| Average Mass | 187.107 |
| Monoisotopic Mass | 187.01278 |
| SMILES | *N[C@@H](CC(C(=O)[O-])C(=O)[O-])C(=O)O* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-carboxy-L-glutamic acid(2−) residue (CHEBI:61941) is a α-amino-acid residue anion (CHEBI:35416) |
| γ-carboxy-L-glutamic acid(2−) residue (CHEBI:61941) is conjugate base of γ-carboxy-L-glutamic acid residue (CHEBI:61939) |
| Incoming Relation(s) |
| γ-carboxy-L-glutamic acid residue (CHEBI:61939) is conjugate acid of γ-carboxy-L-glutamic acid(2−) residue (CHEBI:61941) |
| Synonym | Source |
|---|---|
| γ-carboxy-L-glutamic acid residue(2−) | ChEBI |