EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N6O9P |
| Net Charge | 0 |
| Average Mass | 434.302 |
| Monoisotopic Mass | 434.09511 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)[C@@H](N)CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N6O9P/c14-5(1-20)13(23)28-29(24,25)26-2-6-8(21)9(22)12(27-6)19-4-18-7-10(15)16-3-17-11(7)19/h3-6,8-9,12,20-22H,1-2,14H2,(H,24,25)(H2,15,16,17)/t5-,6+,8+,9+,12+/m0/s1 |
| InChIKey | UVSYURUCZPPUQD-MACXSXHHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-seryl-AMP (CHEBI:61645) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| L-seryl-AMP (CHEBI:61645) is a L-serine derivative (CHEBI:84135) |
| L-seryl-AMP (CHEBI:61645) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| L-seryl-AMP (CHEBI:61645) is conjugate acid of L-seryl-AMP(1−) (CHEBI:61231) |
| Incoming Relation(s) |
| L-seryl-AMP(1−) (CHEBI:61231) is conjugate base of L-seryl-AMP (CHEBI:61645) |
| IUPAC Name |
|---|
| 5'-O-[(L-seryloxy)(hydroxy)phosphoryl]adenosine |
| Synonyms | Source |
|---|---|
| 5'-O-[{[(2S)-2-amino-3-hydroxypropanoyl]oxy}(hydroxy)phosphoryl]adenosine | IUPAC |
| 5'-adenylic acid L-serine anhydride | ChEBI |
| L-seryl-amp | ChemIDplus |
| L-seryl-adenosine monophosphate | ChemIDplus |
| (L-seryl)adenylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05820 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:68350 | Reaxys |
| CAS:52435-67-3 | ChemIDplus |