EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N6O9P |
| Net Charge | -1 |
| Average Mass | 433.294 |
| Monoisotopic Mass | 433.08784 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OC(=O)[C@@H](N)CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N6O9P/c14-5(1-20)13(23)28-29(24,25)26-2-6-8(21)9(22)12(27-6)19-4-18-7-10(15)16-3-17-11(7)19/h3-6,8-9,12,20-22H,1-2,14H2,(H,24,25)(H2,15,16,17)/p-1/t5-,6+,8+,9+,12+/m0/s1 |
| InChIKey | UVSYURUCZPPUQD-MACXSXHHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-seryl-AMP(1−) (CHEBI:61231) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| L-seryl-AMP(1−) (CHEBI:61231) is a organophosphate oxoanion (CHEBI:58945) |
| L-seryl-AMP(1−) (CHEBI:61231) is conjugate base of L-seryl-AMP (CHEBI:61645) |
| Incoming Relation(s) |
| L-seryl-AMP (CHEBI:61645) is conjugate acid of L-seryl-AMP(1−) (CHEBI:61231) |
| IUPAC Name |
|---|
| 5'-O-[(L-seryloxy)phosphinato]adenosine |
| Synonyms | Source |
|---|---|
| 5'-adenylic acid L-serine anhydride(1−) | ChEBI |
| 5'-adenylic acid L-serine anhydride anion | ChEBI |
| 5'-O-({[(2S)-2-amino-3-hydroxypropanoyl]oxy}phosphinato)adenosine | IUPAC |
| L-seryl-adenylate (1-) | SUBMITTER |
| L-seryl-adenylate(1−) | ChEBI |
| L-seryl-AMP (1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| L-seryl-5'-AMP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| SERYL-AMP | MetaCyc |