EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28683 - kynurenine
| Formula | C10H12N2O3 |
| Net Charge | 0 |
| Average Mass | 208.217 |
| Monoisotopic Mass | 208.08479 |
| SMILES | Nc1ccccc1C(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15) |
| InChIKey | YGPSJZOEDVAXAB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (16139256) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kynurenine (CHEBI:28683) has role human metabolite (CHEBI:77746) |
| kynurenine (CHEBI:28683) is a aromatic ketone (CHEBI:76224) |
| kynurenine (CHEBI:28683) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| kynurenine (CHEBI:28683) is a substituted aniline (CHEBI:48975) |
| kynurenine (CHEBI:28683) is conjugate acid of kynureninate (CHEBI:67008) |
| Incoming Relation(s) |
| N-acetylkynurenine (CHEBI:133592) has functional parent kynurenine (CHEBI:28683) |
| N-formylkynurenine (CHEBI:18377) has functional parent kynurenine (CHEBI:28683) |
| hydroxykynurenine (CHEBI:86497) has functional parent kynurenine (CHEBI:28683) |
| D-kynurenine (CHEBI:86262) is a kynurenine (CHEBI:28683) |
| L-kynurenine (CHEBI:16946) is a kynurenine (CHEBI:28683) |
| kynureninate (CHEBI:67008) is conjugate base of kynurenine (CHEBI:28683) |
| IUPAC Name |
|---|
| 2-amino-4-(2-aminophenyl)-4-oxobutanoic acid |
| Synonym | Source |
|---|---|
| Kynurenine | KEGG COMPOUND |
| Citations |
|---|