EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O4 |
| Net Charge | 0 |
| Average Mass | 236.227 |
| Monoisotopic Mass | 236.07971 |
| SMILES | [H]C(=O)Nc1ccccc1C(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C11H12N2O4/c12-8(11(16)17)5-10(15)7-3-1-2-4-9(7)13-6-14/h1-4,6,8H,5,12H2,(H,13,14)(H,16,17) |
| InChIKey | BYHJHXPTQMMKCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylkynurenine (CHEBI:18377) has functional parent kynurenine (CHEBI:28683) |
| N-formylkynurenine (CHEBI:18377) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| N-formylkynurenine (CHEBI:18377) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| 5-hydroxy-N-formylkynurenine (CHEBI:2065) has functional parent N-formylkynurenine (CHEBI:18377) |
| N-formyl-L-kynurenine (CHEBI:30249) is a N-formylkynurenine (CHEBI:18377) |
| IUPAC Name |
|---|
| 2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 2-amino-4-(2-formamidophenyl)-4-oxo-butanoic acid | ChEBI |
| 3-(2-formamidobenzoyl)alanine | ChEBI |
| N'-formylkynurenine | ChEBI |
| N-formylkynurenine | ChEBI |
| formylkynurenine | ChEBI |
| α-amino-2-(formylamino)-γ-oxobenzenebutanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00058937 | KNApSAcK |
| FDB022486 | FooDB |
| HMDB0001200 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1022-31-7 | ChEBI |
| Citations |
|---|